C43H78NO8P — CID 165297636
[2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (12Z,15Z,18Z)-tetracosa-12,15,18-trienoate (PubChem CID 165297636) has the molecular formula C43H78NO8P and a molecular weight of 768.07 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (12Z,15Z,18Z)-tetracosa-12,15,18-trienoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (12Z,15Z,18Z)-tetracosa-12,15,18-trienoate |
|---|---|
| PubChem CID | 165297636 |
| Molecular Formula | C43H78NO8P |
| Molecular Weight | 768.07 g/mol |
| Exact Mass | 767.55 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(Z)-tetradec-9-enoyl]amino]ethoxy]phosphoryl]oxypropyl] (12Z,15Z,18Z)-tetracosa-12,15,18-trienoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)NCCOP(=O)(O)OCC(O)COC(=O)CCCCCCCCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H78NO8P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-32-34-36-43(47)50-39-41(45)40-52-53(48,49)51-38-37-44-42(46)35-33-31-29-27-25-14-12-10-8-6-4-2/h10-13,16-17,19-20,41,45H,3-9,14-15,18,21-40H2,1-2H3,(H,44,46)(H,48,49)/b12-10-,13-11-,17-16-,20-19- |
| InChIKey | SWCQMZZPNOKYKH-XQUOWRLLSA-N |
| XLogP | 11.55 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.07 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|