C25H28N8S2 — CID 121371839
N,N'-dimethyl-N,N'-bis[3-methyl-4-(1,3-thiazol-2-yldiazenyl)phenyl]propane-1,3-diamine (PubChem CID 121371839) has the molecular formula C25H28N8S2 and a molecular weight of 504.69 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[3-methyl-4-(1,3-thiazol-2-yldiazenyl)phenyl]propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[3-methyl-4-(1,3-thiazol-2-yldiazenyl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 121371839 |
| Molecular Formula | C25H28N8S2 |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[3-methyl-4-(1,3-thiazol-2-yldiazenyl)phenyl]propane-1,3-diamine |
| SMILES | Cc1cc(N(C)CCCN(C)c2ccc(/N=N/c3nccs3)c(C)c2)ccc1/N=N/c1nccs1 |
| InChI | InChI=1S/C25H28N8S2/c1-18-16-20(6-8-22(18)28-30-24-26-10-14-34-24)32(3)12-5-13-33(4)21-7-9-23(19(2)17-21)29-31-25-27-11-15-35-25/h6-11,14-17H,5,12-13H2,1-4H3/b30-28+,31-29+ |
| InChIKey | ICFAGSDXZHSZAC-FUEWEDNTSA-N |
| XLogP | 8.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|