C17H21N6S+ — CID 87796008
N-ethyl-N-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-4-(1,3-thiazol-2-yldiazenyl)aniline (PubChem CID 87796008) has the molecular formula C17H21N6S+ and a molecular weight of 341.46 g/mol. Its IUPAC name is N-ethyl-N-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-4-(1,3-thiazol-2-yldiazenyl)aniline.
| Compound Name | N-ethyl-N-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-4-(1,3-thiazol-2-yldiazenyl)aniline |
|---|---|
| PubChem CID | 87796008 |
| Molecular Formula | C17H21N6S+ |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-ethyl-N-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-4-(1,3-thiazol-2-yldiazenyl)aniline |
| SMILES | CCN(CCc1[nH]cc[n+]1C)c1ccc(/N=N/c2nccs2)cc1 |
| InChI | InChI=1S/C17H20N6S/c1-3-23(11-8-16-18-9-12-22(16)2)15-6-4-14(5-7-15)20-21-17-19-10-13-24-17/h4-7,9-10,12-13H,3,8,11H2,1-2H3/p+1/b21-20+ |
| InChIKey | PGVBWNJOQCAXPT-QZQOTICOSA-O |
| XLogP | 3.78 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|