C21H25N4S+ — CID 58601753
N-ethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-propylaniline (PubChem CID 58601753) has the molecular formula C21H25N4S+ and a molecular weight of 365.53 g/mol. Its IUPAC name is N-ethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-propylaniline.
| Compound Name | N-ethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-propylaniline |
|---|---|
| PubChem CID | 58601753 |
| Molecular Formula | C21H25N4S+ |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-ethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-propylaniline |
| SMILES | CCCN(CC)c1ccc(/N=N/c2scc(-c3ccccc3)[n+]2C)cc1 |
| InChI | InChI=1S/C21H25N4S/c1-4-15-25(5-2)19-13-11-18(12-14-19)22-23-21-24(3)20(16-26-21)17-9-7-6-8-10-17/h6-14,16H,4-5,15H2,1-3H3/q+1 |
| InChIKey | YJHKYYZUXQZYQO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|