C18H20N6O — CID 136678232
2-[N-ethyl-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)diazenyl]anilino]ethanol (PubChem CID 136678232) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)diazenyl]anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)diazenyl]anilino]ethanol |
|---|---|
| PubChem CID | 136678232 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[N-ethyl-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)diazenyl]anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/N=N/c2n[nH]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H20N6O/c1-2-24(12-13-25)16-10-8-15(9-11-16)20-22-18-19-17(21-23-18)14-6-4-3-5-7-14/h3-11,25H,2,12-13H2,1H3,(H,19,21,23)/b22-20+ |
| InChIKey | DNGZKQGDGMZMLE-LSDHQDQOSA-N |
| XLogP | 3.71 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|