C36H36F4N6O2S2 — CID 15507534
2-[N-ethyl-4-[[4-[2-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanyl-3,3,4,4-tetrafluorocyclobuten-1-yl]sulfanylphenyl]diazenyl]anilino]ethanol (PubChem CID 15507534) has the molecular formula C36H36F4N6O2S2 and a molecular weight of 724.85 g/mol. Its IUPAC name is 2-[N-ethyl-4-[[4-[2-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanyl-3,3,4,4-tetrafluorocyclobuten-1-yl]sulfanylphenyl]diazenyl]anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-[[4-[2-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanyl-3,3,4,4-tetrafluorocyclobuten-1-yl]sulfanylphenyl]diazenyl]anilino]ethanol |
|---|---|
| PubChem CID | 15507534 |
| Molecular Formula | C36H36F4N6O2S2 |
| Molecular Weight | 724.85 g/mol |
| Exact Mass | 724.23 |
| IUPAC Name | 2-[N-ethyl-4-[[4-[2-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanyl-3,3,4,4-tetrafluorocyclobuten-1-yl]sulfanylphenyl]diazenyl]anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/N=N/c2ccc(SC3=C(Sc4ccc(/N=N/c5ccc(N(CC)CCO)cc5)cc4)C(F)(F)C3(F)F)cc2)cc1 |
| InChI | InChI=1S/C36H36F4N6O2S2/c1-3-45(21-23-47)29-13-5-25(6-14-29)41-43-27-9-17-31(18-10-27)49-33-34(36(39,40)35(33,37)38)50-32-19-11-28(12-20-32)44-42-26-7-15-30(16-8-26)46(4-2)22-24-48/h5-20,47-48H,3-4,21-24H2,1-2H3/b43-41+,44-42+ |
| InChIKey | WWJSLEAFMQZYIY-CHQNLTHESA-N |
| XLogP | 10.53 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.85 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|