C16H17N5O — CID 58988592
2-[N-ethyl-4-[(6-isocyano-3-pyridinyl)diazenyl]anilino]ethanol (PubChem CID 58988592) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(6-isocyano-3-pyridinyl)diazenyl]anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-[(6-isocyano-3-pyridinyl)diazenyl]anilino]ethanol |
|---|---|
| PubChem CID | 58988592 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[N-ethyl-4-[(6-isocyano-3-pyridinyl)diazenyl]anilino]ethanol |
| SMILES | [C-]#[N+]c1ccc(/N=N/c2ccc(N(CC)CCO)cc2)cn1 |
| InChI | InChI=1S/C16H17N5O/c1-3-21(10-11-22)15-7-4-13(5-8-15)19-20-14-6-9-16(17-2)18-12-14/h4-9,12,22H,3,10-11H2,1H3/b20-19+ |
| InChIKey | GMBXVWZAXWPOBP-FMQUCBEESA-N |
| XLogP | 3.87 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|