C32H36N6O2S — CID 102049909
2-[N-ethyl-4-[[4-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanylphenyl]diazenyl]anilino]ethanol (PubChem CID 102049909) has the molecular formula C32H36N6O2S and a molecular weight of 568.75 g/mol. Its IUPAC name is 2-[N-ethyl-4-[[4-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanylphenyl]diazenyl]anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-[[4-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanylphenyl]diazenyl]anilino]ethanol |
|---|---|
| PubChem CID | 102049909 |
| Molecular Formula | C32H36N6O2S |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 2-[N-ethyl-4-[[4-[4-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]diazenyl]phenyl]sulfanylphenyl]diazenyl]anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/N=N/c2ccc(Sc3ccc(/N=N/c4ccc(N(CC)CCO)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H36N6O2S/c1-3-37(21-23-39)29-13-5-25(6-14-29)33-35-27-9-17-31(18-10-27)41-32-19-11-28(12-20-32)36-34-26-7-15-30(16-8-26)38(4-2)22-24-40/h5-20,39-40H,3-4,21-24H2,1-2H3/b35-33+,36-34+ |
| InChIKey | PRYFQBINHHUKBV-LBYUQGKWSA-N |
| XLogP | 8.31 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|