C32H38N6O2 — CID 129305982
2-[4-[[8-(diethylamino)-10-phenyl-5,10a-dihydro-4aH-phenazin-2-yl]diazenyl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 129305982) has the molecular formula C32H38N6O2 and a molecular weight of 538.70 g/mol. Its IUPAC name is 2-[4-[[8-(diethylamino)-10-phenyl-5,10a-dihydro-4aH-phenazin-2-yl]diazenyl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[[8-(diethylamino)-10-phenyl-5,10a-dihydro-4aH-phenazin-2-yl]diazenyl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 129305982 |
| Molecular Formula | C32H38N6O2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 2-[4-[[8-(diethylamino)-10-phenyl-5,10a-dihydro-4aH-phenazin-2-yl]diazenyl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | CCN(CC)c1ccc2c(c1)N(c1ccccc1)C1C=C(/N=N/c3ccc(N(CCO)CCO)cc3)C=CC1N2 |
| InChI | InChI=1S/C32H38N6O2/c1-3-36(4-2)28-15-17-30-32(23-28)38(27-8-6-5-7-9-27)31-22-25(12-16-29(31)33-30)35-34-24-10-13-26(14-11-24)37(18-20-39)19-21-40/h5-17,22-23,29,31,33,39-40H,3-4,18-21H2,1-2H3/b35-34+ |
| InChIKey | BUTLAMYMJNWPSA-XAHDOWKMSA-N |
| XLogP | 5.86 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|