C26H27N4S+ — CID 87674006
N,N-dibenzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline (PubChem CID 87674006) has the molecular formula C26H27N4S+ and a molecular weight of 427.60 g/mol. Its IUPAC name is N,N-dibenzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline.
| Compound Name | N,N-dibenzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 87674006 |
| Molecular Formula | C26H27N4S+ |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N,N-dibenzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline |
| SMILES | Cc1sc(/N=N/c2ccc(N(Cc3ccccc3)Cc3ccccc3)cc2)[n+](C)c1C |
| InChI | InChI=1S/C26H27N4S/c1-20-21(2)31-26(29(20)3)28-27-24-14-16-25(17-15-24)30(18-22-10-6-4-7-11-22)19-23-12-8-5-9-13-23/h4-17H,18-19H2,1-3H3/q+1 |
| InChIKey | FCRUGNJDIZCGPY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|