C15H19N4O2+ — CID 136785700
2-[N-(2-hydroxyethyl)-4-(pyridin-1-ium-3-yldiazenyl)anilino]ethanol (PubChem CID 136785700) has the molecular formula C15H19N4O2+ and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-(pyridin-1-ium-3-yldiazenyl)anilino]ethanol.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-(pyridin-1-ium-3-yldiazenyl)anilino]ethanol |
|---|---|
| PubChem CID | 136785700 |
| Molecular Formula | C15H19N4O2+ |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-(pyridin-1-ium-3-yldiazenyl)anilino]ethanol |
| SMILES | OCCN(CCO)c1ccc(/N=N/c2ccc[nH+]c2)cc1 |
| InChI | InChI=1S/C15H18N4O2/c20-10-8-19(9-11-21)15-5-3-13(4-6-15)17-18-14-2-1-7-16-12-14/h1-7,12,20-21H,8-11H2/p+1/b18-17+ |
| InChIKey | HTXSQVJHHJVRGG-ISLYRVAYSA-O |
| XLogP | 1.71 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|