About bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium
bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium (PubChem CID 171731418) has the molecular formula C32H36N8O8V
and a molecular weight of 711.63 g/mol. Its IUPAC name is bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium.
Molecular Properties
| Compound Name | bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium |
| PubChem CID | 171731418 |
| Molecular Formula | C32H36N8O8V |
| Molecular Weight | 711.63 g/mol |
| Exact Mass | 711.21 |
| IUPAC Name | bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium |
| SMILES | CCN(CC)c1ccc(/N=N\c2ccc([N+](=O)[O-])cc2O)c(O)c1.CCN(CC)c1ccc(/N=N\c2ccc([N+](=O)[O-])cc2O)c(O)c1.[V] |
| InChI | InChI=1S/2C16H18N4O4.V/c2*1-3-19(4-2)11-5-7-13(15(21)9-11)17-18-14-8-6-12(20(23)24)10-16(14)22;/h2*5-10,21-22H,3-4H2,1-2H3;/b2*18-17-; |
| InChIKey | ISFWRELOYDFAIJ-PTZSQULPSA-N |
| XLogP | 8.53 |
| TPSA | 223.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 711.63 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium?
The IUPAC name of bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium (CID 171731418) is bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium.
What is the SMILES notation for bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium?
The canonical SMILES for bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium is CCN(CC)c1ccc(/N=N\c2ccc([N+](=O)[O-])cc2O)c(O)c1.CCN(CC)c1ccc(/N=N\c2ccc([N+](=O)[O-])cc2O)c(O)c1.[V].
What is the InChIKey of bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium?
The InChIKey is ISFWRELOYDFAIJ-PTZSQULPSA-N. The full InChI is InChI=1S/2C16H18N4O4.V/c2*1-3-19(4-2)11-5-7-13(15(21)9-11)17-18-14-8-6-12(20(23)24)10-16(14)22;/h2*5-10,21-22H,3-4H2,1-2H3;/b2*18-17-;.
What are the key properties of bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium?
bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium has a molecular weight of 711.63 g/mol, XLogP of 8.53, 12 rotatable bonds, 4 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-(diethylamino)-2-[(2-hydroxy-4-nitrophenyl)diazenyl]phenol);vanadium is sourced from PubChem (CID 171731418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).