C18H22N4O9S2 — CID 136882825
3-[3-hydroxy-4-[(4-nitrophenyl)diazenyl]-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid (PubChem CID 136882825) has the molecular formula C18H22N4O9S2 and a molecular weight of 502.53 g/mol. Its IUPAC name is 3-[3-hydroxy-4-[(4-nitrophenyl)diazenyl]-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid.
| Compound Name | 3-[3-hydroxy-4-[(4-nitrophenyl)diazenyl]-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 136882825 |
| Molecular Formula | C18H22N4O9S2 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 3-[3-hydroxy-4-[(4-nitrophenyl)diazenyl]-N-(3-sulfopropyl)anilino]propane-1-sulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)cc2O)cc1 |
| InChI | InChI=1S/C18H22N4O9S2/c23-18-13-16(21(9-1-11-32(26,27)28)10-2-12-33(29,30)31)7-8-17(18)20-19-14-3-5-15(6-4-14)22(24)25/h3-8,13,23H,1-2,9-12H2,(H,26,27,28)(H,29,30,31)/b20-19+ |
| InChIKey | WELJMSNCHKSBDV-FMQUCBEESA-N |
| XLogP | 3.08 |
| TPSA | 200.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|