C22H25N5O8 — CID 159643523
2-[N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]-3-methylanilino]ethyl acetate;isocyanic acid (PubChem CID 159643523) has the molecular formula C22H25N5O8 and a molecular weight of 487.47 g/mol. Its IUPAC name is 2-[N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]-3-methylanilino]ethyl acetate;isocyanic acid.
| Compound Name | 2-[N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]-3-methylanilino]ethyl acetate;isocyanic acid |
|---|---|
| PubChem CID | 159643523 |
| Molecular Formula | C22H25N5O8 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 2-[N-(2-acetyloxyethyl)-4-[(2-hydroxy-4-nitrophenyl)diazenyl]-3-methylanilino]ethyl acetate;isocyanic acid |
| SMILES | CC(=O)OCCN(CCOC(C)=O)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2O)c(C)c1.N=C=O |
| InChI | InChI=1S/C21H24N4O7.CHNO/c1-14-12-17(24(8-10-31-15(2)26)9-11-32-16(3)27)4-6-19(14)22-23-20-7-5-18(25(29)30)13-21(20)28;2-1-3/h4-7,12-13,28H,8-11H2,1-3H3;2H/b23-22+; |
| InChIKey | MQQYBIQSNRNIRI-PGCQSHBKSA-N |
| XLogP | 3.86 |
| TPSA | 184.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|