C17H18N4O4 — CID 102398892
4-[(2,4-dinitrophenyl)iminomethyl]-N,N-diethylaniline (PubChem CID 102398892) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-[(2,4-dinitrophenyl)iminomethyl]-N,N-diethylaniline.
| Compound Name | 4-[(2,4-dinitrophenyl)iminomethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 102398892 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-[(2,4-dinitrophenyl)iminomethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N4O4/c1-3-19(4-2)14-7-5-13(6-8-14)12-18-16-10-9-15(20(22)23)11-17(16)21(24)25/h5-12H,3-4H2,1-2H3/b18-12+ |
| InChIKey | ADHWDCVBWMDZJY-LDADJPATSA-N |
| XLogP | 4.10 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|