C7H6N4O4 — CID 89273511
N'-(2,4-dinitrophenyl)methanimidamide (PubChem CID 89273511) has the molecular formula C7H6N4O4 and a molecular weight of 210.15 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)methanimidamide.
| Compound Name | N'-(2,4-dinitrophenyl)methanimidamide |
|---|---|
| PubChem CID | 89273511 |
| Molecular Formula | C7H6N4O4 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | N'-(2,4-dinitrophenyl)methanimidamide |
| SMILES | N/C=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N4O4/c8-4-9-6-2-1-5(10(12)13)3-7(6)11(14)15/h1-4H,(H2,8,9) |
| InChIKey | NRKDUTAHIALVCW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|