C12H10N4O4 — CID 10869482
N-(2,4-dinitrophenyl)-1-methylpyridin-4-imine (PubChem CID 10869482) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-1-methylpyridin-4-imine.
| Compound Name | N-(2,4-dinitrophenyl)-1-methylpyridin-4-imine |
|---|---|
| PubChem CID | 10869482 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N-(2,4-dinitrophenyl)-1-methylpyridin-4-imine |
| SMILES | Cn1ccc(=Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N4O4/c1-14-6-4-9(5-7-14)13-11-3-2-10(15(17)18)8-12(11)16(19)20/h2-8H,1H3 |
| InChIKey | VHMXJWJAAWXYSW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 103.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|