C14H13N5O5S — CID 27102282
(2,4-dinitrophenyl)-(5-morpholin-4-ylthiophen-2-yl)diazene (PubChem CID 27102282) has the molecular formula C14H13N5O5S and a molecular weight of 363.36 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-(5-morpholin-4-ylthiophen-2-yl)diazene.
| Compound Name | (2,4-dinitrophenyl)-(5-morpholin-4-ylthiophen-2-yl)diazene |
|---|---|
| PubChem CID | 27102282 |
| Molecular Formula | C14H13N5O5S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | (2,4-dinitrophenyl)-(5-morpholin-4-ylthiophen-2-yl)diazene |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc(N3CCOCC3)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N5O5S/c20-18(21)10-1-2-11(12(9-10)19(22)23)15-16-13-3-4-14(25-13)17-5-7-24-8-6-17/h1-4,9H,5-8H2/b16-15+ |
| InChIKey | JKIDMOLFUUJPJR-FOCLMDBBSA-N |
| XLogP | 3.82 |
| TPSA | 123.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|