C9H10N4O5 — CID 2847997
4-(3,5-dinitro-2-pyridinyl)morpholine (PubChem CID 2847997) has the molecular formula C9H10N4O5 and a molecular weight of 254.20 g/mol. Its IUPAC name is 4-(3,5-dinitro-2-pyridinyl)morpholine.
| Compound Name | 4-(3,5-dinitro-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 2847997 |
| Molecular Formula | C9H10N4O5 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 4-(3,5-dinitro-2-pyridinyl)morpholine |
| SMILES | O=[N+]([O-])c1cnc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N4O5/c14-12(15)7-5-8(13(16)17)9(10-6-7)11-1-3-18-4-2-11/h5-6H,1-4H2 |
| InChIKey | OLMXISBUEJLUJL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|