C11H13N3O5 — CID 114046762
5-nitro-2-(1,4-oxazepan-4-yl)pyridine-3-carboxylic acid (PubChem CID 114046762) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 5-nitro-2-(1,4-oxazepan-4-yl)pyridine-3-carboxylic acid.
| Compound Name | 5-nitro-2-(1,4-oxazepan-4-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114046762 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-nitro-2-(1,4-oxazepan-4-yl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cnc1N1CCCOCC1 |
| InChI | InChI=1S/C11H13N3O5/c15-11(16)9-6-8(14(17)18)7-12-10(9)13-2-1-4-19-5-3-13/h6-7H,1-5H2,(H,15,16) |
| InChIKey | PJHUKGCSVCSPJK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|