C11H12N4O3 — CID 67155951
4-(5-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)morpholine (PubChem CID 67155951) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is 4-(5-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)morpholine.
| Compound Name | 4-(5-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)morpholine |
|---|---|
| PubChem CID | 67155951 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(5-nitro-1H-pyrrolo[2,3-b]pyridin-3-yl)morpholine |
| SMILES | O=[N+]([O-])c1cnc2[nH]cc(N3CCOCC3)c2c1 |
| InChI | InChI=1S/C11H12N4O3/c16-15(17)8-5-9-10(7-13-11(9)12-6-8)14-1-3-18-4-2-14/h5-7H,1-4H2,(H,12,13) |
| InChIKey | BIBBSGAZDSFEPK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|