About morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one
morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one (PubChem CID 158641955) has the molecular formula C17H22N4O5
and a molecular weight of 362.39 g/mol. Its IUPAC name is morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one |
| PubChem CID | 158641955 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one |
| SMILES | C1COCCN1.O=c1cc(N2CCOCC2)c2ccc([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C13H13N3O4.C4H9NO/c17-13-8-12(15-3-5-20-6-4-15)10-2-1-9(16(18)19)7-11(10)14-13;1-3-6-4-2-5-1/h1-2,7-8H,3-6H2,(H,14,17);5H,1-4H2 |
| InChIKey | IAMNAQGVCXXEPJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one?
The IUPAC name of morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one (CID 158641955) is morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one.
What is the SMILES notation for morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one?
The canonical SMILES for morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one is C1COCCN1.O=c1cc(N2CCOCC2)c2ccc([N+](=O)[O-])cc2[nH]1.
What is the InChIKey of morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one?
The InChIKey is IAMNAQGVCXXEPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4.C4H9NO/c17-13-8-12(15-3-5-20-6-4-15)10-2-1-9(16(18)19)7-11(10)14-13;1-3-6-4-2-5-1/h1-2,7-8H,3-6H2,(H,14,17);5H,1-4H2.
What are the key properties of morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one?
morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one has a molecular weight of 362.39 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;4-morpholin-4-yl-7-nitro-1H-quinolin-2-one is sourced from PubChem (CID 158641955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).