C10H11N3O4 — CID 143070523
ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (PubChem CID 143070523) has the molecular formula C10H11N3O4 and a molecular weight of 237.22 g/mol. Its IUPAC name is ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid.
| Compound Name | ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143070523 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid |
| SMILES | CC.O=C(O)c1c[nH]c2ncc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C8H5N3O4.C2H6/c12-8(13)6-3-10-7-5(6)1-4(2-9-7)11(14)15;1-2/h1-3H,(H,9,10)(H,12,13);1-2H3 |
| InChIKey | JVEHJJDHPOYHLH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|