ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

C10H11N3O4 — CID 143070523

IUPACethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
SMILESCC.O=C(O)c1c[nH]c2ncc([N+](=O)[O-])cc12
InChIInChI=1S/C8H5N3O4.C2H6/c12-8(13)6-3-10-7-5(6)1-4(2-9-7)11(14)15;1-2/h1-3H,(H,9,10)(H,12,13);1-2H3
InChIKeyJVEHJJDHPOYHLH-UHFFFAOYSA-N
MW237.22 g/mol
LogP2.20
Rot. Bonds2

About ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (PubChem CID 143070523) has the molecular formula C10H11N3O4 and a molecular weight of 237.22 g/mol. Its IUPAC name is ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid.

Molecular Properties

Compound Nameethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
PubChem CID143070523
Molecular FormulaC10H11N3O4
Molecular Weight237.22 g/mol
Exact Mass237.07
IUPAC Nameethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
SMILESCC.O=C(O)c1c[nH]c2ncc([N+](=O)[O-])cc12
InChIInChI=1S/C8H5N3O4.C2H6/c12-8(13)6-3-10-7-5(6)1-4(2-9-7)11(14)15;1-2/h1-3H,(H,9,10)(H,12,13);1-2H3
InChIKeyJVEHJJDHPOYHLH-UHFFFAOYSA-N
XLogP2.20
TPSA109.12 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.22
LogP ≤ 52.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid?
The IUPAC name of ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CID 143070523) is ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid.
What is the SMILES notation for ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid?
The canonical SMILES for ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is CC.O=C(O)c1c[nH]c2ncc([N+](=O)[O-])cc12.
What is the InChIKey of ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid?
The InChIKey is JVEHJJDHPOYHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O4.C2H6/c12-8(13)6-3-10-7-5(6)1-4(2-9-7)11(14)15;1-2/h1-3H,(H,9,10)(H,12,13);1-2H3.
What are the key properties of ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid?
ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid has a molecular weight of 237.22 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is sourced from PubChem (CID 143070523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).