C7H4N4O4 — CID 86207952
5-nitro-2H-pyrazolo[3,4-b]pyridine-3-carboxylic acid (PubChem CID 86207952) has the molecular formula C7H4N4O4 and a molecular weight of 208.13 g/mol. Its IUPAC name is 5-nitro-2H-pyrazolo[3,4-b]pyridine-3-carboxylic acid.
| Compound Name | 5-nitro-2H-pyrazolo[3,4-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 86207952 |
| Molecular Formula | C7H4N4O4 |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 5-nitro-2H-pyrazolo[3,4-b]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1[nH]nc2ncc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C7H4N4O4/c12-7(13)5-4-1-3(11(14)15)2-8-6(4)10-9-5/h1-2H,(H,12,13)(H,8,9,10) |
| InChIKey | IKRZBWRXRGSIBG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|