C8H6N4O3S — CID 6611040
3-amino-5-nitrothieno[2,3-b]pyridine-2-carboxamide (PubChem CID 6611040) has the molecular formula C8H6N4O3S and a molecular weight of 238.23 g/mol. Its IUPAC name is 3-amino-5-nitrothieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-5-nitrothieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 6611040 |
| Molecular Formula | C8H6N4O3S |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 3-amino-5-nitrothieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2ncc([N+](=O)[O-])cc2c1N |
| InChI | InChI=1S/C8H6N4O3S/c9-5-4-1-3(12(14)15)2-11-8(4)16-6(5)7(10)13/h1-2H,9H2,(H2,10,13) |
| InChIKey | ZUZRGXVIMFBFCV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|