C7H7N5O2 — CID 171705544
2-methyl-5-nitropyrazolo[3,4-b]pyridin-3-amine (PubChem CID 171705544) has the molecular formula C7H7N5O2 and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-methyl-5-nitropyrazolo[3,4-b]pyridin-3-amine.
| Compound Name | 2-methyl-5-nitropyrazolo[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 171705544 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-methyl-5-nitropyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Cn1nc2ncc([N+](=O)[O-])cc2c1N |
| InChI | InChI=1S/C7H7N5O2/c1-11-6(8)5-2-4(12(13)14)3-9-7(5)10-11/h2-3H,8H2,1H3 |
| InChIKey | PQXMEICJZWBODX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|