C14H10N6O4 — CID 44550526
3-(4-methyl-6-nitro-1,8-naphthyridin-2-yl)-5-nitropyridin-2-amine (PubChem CID 44550526) has the molecular formula C14H10N6O4 and a molecular weight of 326.27 g/mol. Its IUPAC name is 3-(4-methyl-6-nitro-1,8-naphthyridin-2-yl)-5-nitropyridin-2-amine.
| Compound Name | 3-(4-methyl-6-nitro-1,8-naphthyridin-2-yl)-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 44550526 |
| Molecular Formula | C14H10N6O4 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-(4-methyl-6-nitro-1,8-naphthyridin-2-yl)-5-nitropyridin-2-amine |
| SMILES | Cc1cc(-c2cc([N+](=O)[O-])cnc2N)nc2ncc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C14H10N6O4/c1-7-2-12(11-4-9(20(23)24)5-16-13(11)15)18-14-10(7)3-8(6-17-14)19(21)22/h2-6H,1H3,(H2,15,16) |
| InChIKey | NUMPPYBRLYHNMA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|