C7H4N4O3 — CID 137302564
6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 137302564) has the molecular formula C7H4N4O3 and a molecular weight of 192.13 g/mol. Its IUPAC name is 6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137302564 |
| Molecular Formula | C7H4N4O3 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 6-nitro-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2ncc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C7H4N4O3/c12-7-5-1-4(11(13)14)2-8-6(5)9-3-10-7/h1-3H,(H,8,9,10,12) |
| InChIKey | IHNPSZKFGZXAEL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|