C8H5F3N4O2 — CID 67089093
5-nitro-3-(2,2,2-trifluoroethyl)-2H-pyrazolo[3,4-b]pyridine (PubChem CID 67089093) has the molecular formula C8H5F3N4O2 and a molecular weight of 246.15 g/mol. Its IUPAC name is 5-nitro-3-(2,2,2-trifluoroethyl)-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 5-nitro-3-(2,2,2-trifluoroethyl)-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 67089093 |
| Molecular Formula | C8H5F3N4O2 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 5-nitro-3-(2,2,2-trifluoroethyl)-2H-pyrazolo[3,4-b]pyridine |
| SMILES | O=[N+]([O-])c1cnc2n[nH]c(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C8H5F3N4O2/c9-8(10,11)2-6-5-1-4(15(16)17)3-12-7(5)14-13-6/h1,3H,2H2,(H,12,13,14) |
| InChIKey | ZQCXTXNBFRJQFV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|