C8H9N5O2 — CID 58227806
N,N-dimethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine (PubChem CID 58227806) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is N,N-dimethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine.
| Compound Name | N,N-dimethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 58227806 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N,N-dimethyl-5-nitro-1H-pyrazolo[5,4-b]pyridin-3-amine |
| SMILES | CN(C)c1n[nH]c2ncc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C8H9N5O2/c1-12(2)8-6-3-5(13(14)15)4-9-7(6)10-11-8/h3-4H,1-2H3,(H,9,10,11) |
| InChIKey | SGWHXXMYXOTQTP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|