C7H4BrF3N2O3 — CID 53407765
3-bromo-5-nitro-2-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 53407765) has the molecular formula C7H4BrF3N2O3 and a molecular weight of 301.02 g/mol. Its IUPAC name is 3-bromo-5-nitro-2-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 3-bromo-5-nitro-2-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 53407765 |
| Molecular Formula | C7H4BrF3N2O3 |
| Molecular Weight | 301.02 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 3-bromo-5-nitro-2-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | O=[N+]([O-])c1cnc(OCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C7H4BrF3N2O3/c8-5-1-4(13(14)15)2-12-6(5)16-3-7(9,10)11/h1-2H,3H2 |
| InChIKey | RKXYCFFXBJGPMH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.02 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|