About [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol
[5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol (PubChem CID 67509343) has the molecular formula C8H7BrF3NO2
and a molecular weight of 286.05 g/mol. Its IUPAC name is [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol |
| PubChem CID | 67509343 |
| Molecular Formula | C8H7BrF3NO2 |
| Molecular Weight | 286.05 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol |
| SMILES | OCc1cnc(OCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C8H7BrF3NO2/c9-6-1-5(3-14)2-13-7(6)15-4-8(10,11)12/h1-2,14H,3-4H2 |
| InChIKey | ADIUYGDLVBJEAG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.05 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol?
The IUPAC name of [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol (CID 67509343) is [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol.
What is the SMILES notation for [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol?
The canonical SMILES for [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol is OCc1cnc(OCC(F)(F)F)c(Br)c1.
What is the InChIKey of [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol?
The InChIKey is ADIUYGDLVBJEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrF3NO2/c9-6-1-5(3-14)2-13-7(6)15-4-8(10,11)12/h1-2,14H,3-4H2.
What are the key properties of [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol?
[5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol has a molecular weight of 286.05 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-bromo-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanol is sourced from PubChem (CID 67509343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).