About 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one
6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 172684386) has the molecular formula C7H3Cl2N3O
and a molecular weight of 216.03 g/mol. Its IUPAC name is 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 172684386 |
| Molecular Formula | C7H3Cl2N3O |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2nc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C7H3Cl2N3O/c8-4-1-3-6(12-5(4)9)10-2-11-7(3)13/h1-2H,(H,10,11,12,13) |
| InChIKey | AVKSACCPUAKWDS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one (CID 172684386) is 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one is O=c1[nH]cnc2nc(Cl)c(Cl)cc12.
What is the InChIKey of 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is AVKSACCPUAKWDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2N3O/c8-4-1-3-6(12-5(4)9)10-2-11-7(3)13/h1-2H,(H,10,11,12,13).
What are the key properties of 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one?
6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 216.03 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-3H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 172684386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).