C8H9N5O — CID 135408571
2-(dimethylamino)-6H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 135408571) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(dimethylamino)-6H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 2-(dimethylamino)-6H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 135408571 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-(dimethylamino)-6H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | CN(C)c1ncc2c(=O)[nH]cnc2n1 |
| InChI | InChI=1S/C8H9N5O/c1-13(2)8-9-3-5-6(12-8)10-4-11-7(5)14/h3-4H,1-2H3,(H,9,10,11,12,14) |
| InChIKey | JPVGQXAZPHBLKP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |