C5H4N4OPb — CID 135618481
CID 135618481 (PubChem CID 135618481) has the molecular formula C5H4N4OPb and a molecular weight of 343.31 g/mol.
| Compound Name | CID 135618481 |
|---|---|
| PubChem CID | 135618481 |
| Molecular Formula | C5H4N4OPb |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | — |
| SMILES | O=c1[nH]cnc2[nH]ncc12.[Pb] |
| InChI | InChI=1S/C5H4N4O.Pb/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10); |
| InChIKey | RKWAZJZPWYAULR-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |