C6H4Cl2N4O — CID 137258011
6-(dichloromethyl)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137258011) has the molecular formula C6H4Cl2N4O and a molecular weight of 219.03 g/mol. Its IUPAC name is 6-(dichloromethyl)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-(dichloromethyl)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137258011 |
| Molecular Formula | C6H4Cl2N4O |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 6-(dichloromethyl)-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(Cl)Cl)nc2[nH]ncc12 |
| InChI | InChI=1S/C6H4Cl2N4O/c7-3(8)5-10-4-2(1-9-12-4)6(13)11-5/h1,3H,(H2,9,10,11,12,13) |
| InChIKey | IBEGMKLFJOZXKA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|