C14H13ClN4OS2 — CID 137211377
6-(3-chloro-2-phenylsulfanylpropyl)sulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137211377) has the molecular formula C14H13ClN4OS2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 6-(3-chloro-2-phenylsulfanylpropyl)sulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-(3-chloro-2-phenylsulfanylpropyl)sulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137211377 |
| Molecular Formula | C14H13ClN4OS2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 6-(3-chloro-2-phenylsulfanylpropyl)sulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SCC(CCl)Sc2ccccc2)nc2[nH]ncc12 |
| InChI | InChI=1S/C14H13ClN4OS2/c15-6-10(22-9-4-2-1-3-5-9)8-21-14-17-12-11(7-16-19-12)13(20)18-14/h1-5,7,10H,6,8H2,(H2,16,17,18,19,20) |
| InChIKey | YIHCGDGFTPIKNP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|