C10H8N8O2 — CID 159116799
1,7-dihydropurin-6-one;3,7-dihydropurin-2-one (PubChem CID 159116799) has the molecular formula C10H8N8O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 1,7-dihydropurin-6-one;3,7-dihydropurin-2-one.
| Compound Name | 1,7-dihydropurin-6-one;3,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 159116799 |
| Molecular Formula | C10H8N8O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1,7-dihydropurin-6-one;3,7-dihydropurin-2-one |
| SMILES | O=c1[nH]cnc2nc[nH]c12.O=c1ncc2[nH]cnc2[nH]1 |
| InChI | InChI=1S/2C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5;10-5-6-1-3-4(9-5)8-2-7-3/h2*1-2H,(H2,6,7,8,9,10) |
| InChIKey | KFEOPYHAVMCFDM-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 148.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |