C6H5N5O — CID 135460323
3-methyl-6H-pyrimido[5,4-e][1,2,4]triazin-5-one (PubChem CID 135460323) has the molecular formula C6H5N5O and a molecular weight of 163.14 g/mol. Its IUPAC name is 3-methyl-6H-pyrimido[5,4-e][1,2,4]triazin-5-one.
| Compound Name | 3-methyl-6H-pyrimido[5,4-e][1,2,4]triazin-5-one |
|---|---|
| PubChem CID | 135460323 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 3-methyl-6H-pyrimido[5,4-e][1,2,4]triazin-5-one |
| SMILES | Cc1nnc2nc[nH]c(=O)c2n1 |
| InChI | InChI=1S/C6H5N5O/c1-3-9-4-5(11-10-3)7-2-8-6(4)12/h2H,1H3,(H,7,8,11,12) |
| InChIKey | ABKQRFLLYWKELO-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |