C10H9N5O5 — CID 15153036
4-amino-1-ethyl-3,6-dinitro-1,8-naphthyridin-2-one (PubChem CID 15153036) has the molecular formula C10H9N5O5 and a molecular weight of 279.21 g/mol. Its IUPAC name is 4-amino-1-ethyl-3,6-dinitro-1,8-naphthyridin-2-one.
| Compound Name | 4-amino-1-ethyl-3,6-dinitro-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 15153036 |
| Molecular Formula | C10H9N5O5 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-amino-1-ethyl-3,6-dinitro-1,8-naphthyridin-2-one |
| SMILES | CCn1c(=O)c([N+](=O)[O-])c(N)c2cc([N+](=O)[O-])cnc21 |
| InChI | InChI=1S/C10H9N5O5/c1-2-13-9-6(3-5(4-12-9)14(17)18)7(11)8(10(13)16)15(19)20/h3-4H,2,11H2,1H3 |
| InChIKey | RNNGIHNVTYKWMD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|