About 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one
1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one (PubChem CID 170629377) has the molecular formula C10H9N3O4
and a molecular weight of 235.20 g/mol. Its IUPAC name is 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one |
| PubChem CID | 170629377 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one |
| SMILES | CCn1c(=O)c(O)cc2cc([N+](=O)[O-])cnc21 |
| InChI | InChI=1S/C10H9N3O4/c1-2-12-9-6(4-8(14)10(12)15)3-7(5-11-9)13(16)17/h3-5,14H,2H2,1H3 |
| InChIKey | DEAWARUDMVAKTJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one?
The IUPAC name of 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one (CID 170629377) is 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one.
What is the SMILES notation for 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one?
The canonical SMILES for 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one is CCn1c(=O)c(O)cc2cc([N+](=O)[O-])cnc21.
What is the InChIKey of 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one?
The InChIKey is DEAWARUDMVAKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4/c1-2-12-9-6(4-8(14)10(12)15)3-7(5-11-9)13(16)17/h3-5,14H,2H2,1H3.
What are the key properties of 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one?
1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one has a molecular weight of 235.20 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-hydroxy-6-nitro-1,8-naphthyridin-2-one is sourced from PubChem (CID 170629377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).