C15H17N5O5 — CID 86710739
1-ethyl-2-morpholin-4-yl-6-nitro-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 86710739) has the molecular formula C15H17N5O5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 1-ethyl-2-morpholin-4-yl-6-nitro-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-ethyl-2-morpholin-4-yl-6-nitro-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 86710739 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-ethyl-2-morpholin-4-yl-6-nitro-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1c(N2CCOCC2)c(C(N)=O)c(=O)c2cc([N+](=O)[O-])cnc21 |
| InChI | InChI=1S/C15H17N5O5/c1-2-19-14-10(7-9(8-17-14)20(23)24)12(21)11(13(16)22)15(19)18-3-5-25-6-4-18/h7-8H,2-6H2,1H3,(H2,16,22) |
| InChIKey | IITIWJWZLAQIAD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|