C15H18N6O3 — CID 133280056
2-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide (PubChem CID 133280056) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133280056 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide |
| SMILES | Cn1nccc1C1CCN(c2ncc([N+](=O)[O-])cc2C(N)=O)CC1 |
| InChI | InChI=1S/C15H18N6O3/c1-19-13(2-5-18-19)10-3-6-20(7-4-10)15-12(14(16)22)8-11(9-17-15)21(23)24/h2,5,8-10H,3-4,6-7H2,1H3,(H2,16,22) |
| InChIKey | SCCICRMHSSGIQT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|