C18H20N4O4 — CID 133279381
2-[4-(3-methoxyphenyl)piperidin-1-yl]-5-nitropyridine-3-carboxamide (PubChem CID 133279381) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[4-(3-methoxyphenyl)piperidin-1-yl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[4-(3-methoxyphenyl)piperidin-1-yl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133279381 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[4-(3-methoxyphenyl)piperidin-1-yl]-5-nitropyridine-3-carboxamide |
| SMILES | COc1cccc(C2CCN(c3ncc([N+](=O)[O-])cc3C(N)=O)CC2)c1 |
| InChI | InChI=1S/C18H20N4O4/c1-26-15-4-2-3-13(9-15)12-5-7-21(8-6-12)18-16(17(19)23)10-14(11-20-18)22(24)25/h2-4,9-12H,5-8H2,1H3,(H2,19,23) |
| InChIKey | KSAXVXQKLPCQMD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|