C17H19N5O4S — CID 133278490
2-[4-[(5-methylthiophene-2-carbonyl)amino]piperidin-1-yl]-5-nitropyridine-3-carboxamide (PubChem CID 133278490) has the molecular formula C17H19N5O4S and a molecular weight of 389.44 g/mol. Its IUPAC name is 2-[4-[(5-methylthiophene-2-carbonyl)amino]piperidin-1-yl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[4-[(5-methylthiophene-2-carbonyl)amino]piperidin-1-yl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133278490 |
| Molecular Formula | C17H19N5O4S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-[4-[(5-methylthiophene-2-carbonyl)amino]piperidin-1-yl]-5-nitropyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(c3ncc([N+](=O)[O-])cc3C(N)=O)CC2)s1 |
| InChI | InChI=1S/C17H19N5O4S/c1-10-2-3-14(27-10)17(24)20-11-4-6-21(7-5-11)16-13(15(18)23)8-12(9-19-16)22(25)26/h2-3,8-9,11H,4-7H2,1H3,(H2,18,23)(H,20,24) |
| InChIKey | NFRKESLFRZRXEM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|