C14H17N7O3 — CID 133349682
2-[4-(3-amino-1H-pyrazol-5-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide (PubChem CID 133349682) has the molecular formula C14H17N7O3 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[4-(3-amino-1H-pyrazol-5-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[4-(3-amino-1H-pyrazol-5-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133349682 |
| Molecular Formula | C14H17N7O3 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[4-(3-amino-1H-pyrazol-5-yl)piperidin-1-yl]-5-nitropyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cnc1N1CCC(c2cc(N)n[nH]2)CC1 |
| InChI | InChI=1S/C14H17N7O3/c15-12-6-11(18-19-12)8-1-3-20(4-2-8)14-10(13(16)22)5-9(7-17-14)21(23)24/h5-8H,1-4H2,(H2,16,22)(H3,15,18,19) |
| InChIKey | WQGMKUWJCLLZDH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|