C8H8N4O3 — CID 162519808
3-ethyl-6-nitro-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 162519808) has the molecular formula C8H8N4O3 and a molecular weight of 208.18 g/mol. Its IUPAC name is 3-ethyl-6-nitro-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-ethyl-6-nitro-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 162519808 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-ethyl-6-nitro-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CCn1c(=O)[nH]c2cc([N+](=O)[O-])cnc21 |
| InChI | InChI=1S/C8H8N4O3/c1-2-11-7-6(10-8(11)13)3-5(4-9-7)12(14)15/h3-4H,2H2,1H3,(H,10,13) |
| InChIKey | HWCLIPRVCDUSCC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|