C10H15N3O — CID 91018221
ethane;3-ethyl-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 91018221) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is ethane;3-ethyl-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | ethane;3-ethyl-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 91018221 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | ethane;3-ethyl-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CC.CCn1c(=O)[nH]c2cccnc21 |
| InChI | InChI=1S/C8H9N3O.C2H6/c1-2-11-7-6(10-8(11)12)4-3-5-9-7;1-2/h3-5H,2H2,1H3,(H,10,12);1-2H3 |
| InChIKey | RCXYMNYFZSEWPW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |