C8H6N4O — CID 83415021
2-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetonitrile (PubChem CID 83415021) has the molecular formula C8H6N4O and a molecular weight of 174.16 g/mol. Its IUPAC name is 2-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetonitrile.
| Compound Name | 2-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 83415021 |
| Molecular Formula | C8H6N4O |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetonitrile |
| SMILES | N#CCn1c(=O)[nH]c2cccnc21 |
| InChI | InChI=1S/C8H6N4O/c9-3-5-12-7-6(11-8(12)13)2-1-4-10-7/h1-2,4H,5H2,(H,11,13) |
| InChIKey | ZHACBQSTMWGKAN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |