C14H11N3O2 — CID 50742664
4-benzyl-1H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 50742664) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-benzyl-1H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 4-benzyl-1H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 50742664 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-benzyl-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cccnc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C14H11N3O2/c18-13-14(19)17(9-10-5-2-1-3-6-10)12-11(16-13)7-4-8-15-12/h1-8H,9H2,(H,16,18) |
| InChIKey | STXRZXASFIXKPI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|